C14H17ClO5S — CID 65375489
oxolan-3-ylmethyl 5-chlorosulfonyl-2,4-dimethylbenzoate (PubChem CID 65375489) has the molecular formula C14H17ClO5S and a molecular weight of 332.81 g/mol. Its IUPAC name is oxolan-3-ylmethyl 5-chlorosulfonyl-2,4-dimethylbenzoate.
| Compound Name | oxolan-3-ylmethyl 5-chlorosulfonyl-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 65375489 |
| Molecular Formula | C14H17ClO5S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | oxolan-3-ylmethyl 5-chlorosulfonyl-2,4-dimethylbenzoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)cc1C(=O)OCC1CCOC1 |
| InChI | InChI=1S/C14H17ClO5S/c1-9-5-10(2)13(21(15,17)18)6-12(9)14(16)20-8-11-3-4-19-7-11/h5-6,11H,3-4,7-8H2,1-2H3 |
| InChIKey | IPQNWGIBOYEXPW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |