C12H11Cl3O5S — CID 65375100
oxolan-3-ylmethyl 3,4-dichloro-5-chlorosulfonylbenzoate (PubChem CID 65375100) has the molecular formula C12H11Cl3O5S and a molecular weight of 373.64 g/mol. Its IUPAC name is oxolan-3-ylmethyl 3,4-dichloro-5-chlorosulfonylbenzoate.
| Compound Name | oxolan-3-ylmethyl 3,4-dichloro-5-chlorosulfonylbenzoate |
|---|---|
| PubChem CID | 65375100 |
| Molecular Formula | C12H11Cl3O5S |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | oxolan-3-ylmethyl 3,4-dichloro-5-chlorosulfonylbenzoate |
| SMILES | O=C(OCC1CCOC1)c1cc(Cl)c(Cl)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H11Cl3O5S/c13-9-3-8(4-10(11(9)14)21(15,17)18)12(16)20-6-7-1-2-19-5-7/h3-4,7H,1-2,5-6H2 |
| InChIKey | RJOBWTNBEWSXJM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |