About oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate
oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate (PubChem CID 65374139) has the molecular formula C13H15ClO5S
and a molecular weight of 318.78 g/mol. Its IUPAC name is oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate.
Molecular Properties
| Compound Name | oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate |
| PubChem CID | 65374139 |
| Molecular Formula | C13H15ClO5S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate |
| SMILES | Cc1cc(C(=O)OCC2CCOC2)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H15ClO5S/c1-9-4-11(6-12(5-9)20(14,16)17)13(15)19-8-10-2-3-18-7-10/h4-6,10H,2-3,7-8H2,1H3 |
| InChIKey | ILBBXNHTAZOOAW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate?
The IUPAC name of oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate (CID 65374139) is oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate.
What is the SMILES notation for oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate?
The canonical SMILES for oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate is Cc1cc(C(=O)OCC2CCOC2)cc(S(=O)(=O)Cl)c1.
What is the InChIKey of oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate?
The InChIKey is ILBBXNHTAZOOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO5S/c1-9-4-11(6-12(5-9)20(14,16)17)13(15)19-8-10-2-3-18-7-10/h4-6,10H,2-3,7-8H2,1H3.
What are the key properties of oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate?
oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate has a molecular weight of 318.78 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-ylmethyl 3-chlorosulfonyl-5-methylbenzoate is sourced from PubChem (CID 65374139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).