C12H17ClN2O5S — CID 65373946
oxolan-3-ylmethyl 4-chlorosulfonyl-5-propan-2-yl-1H-pyrazole-3-carboxylate (PubChem CID 65373946) has the molecular formula C12H17ClN2O5S and a molecular weight of 336.80 g/mol. Its IUPAC name is oxolan-3-ylmethyl 4-chlorosulfonyl-5-propan-2-yl-1H-pyrazole-3-carboxylate.
| Compound Name | oxolan-3-ylmethyl 4-chlorosulfonyl-5-propan-2-yl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 65373946 |
| Molecular Formula | C12H17ClN2O5S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | oxolan-3-ylmethyl 4-chlorosulfonyl-5-propan-2-yl-1H-pyrazole-3-carboxylate |
| SMILES | CC(C)c1[nH]nc(C(=O)OCC2CCOC2)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C12H17ClN2O5S/c1-7(2)9-11(21(13,17)18)10(15-14-9)12(16)20-6-8-3-4-19-5-8/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | BGYHKAFPLIEEPM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |