About oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate
oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate (PubChem CID 113309279) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate |
| PubChem CID | 113309279 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate |
| SMILES | NCC1(C(=O)OCC2CCOCC2)CCCC1 |
| InChI | InChI=1S/C13H23NO3/c14-10-13(5-1-2-6-13)12(15)17-9-11-3-7-16-8-4-11/h11H,1-10,14H2 |
| InChIKey | IGNGQERDRCAWMT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate?
The IUPAC name of oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate (CID 113309279) is oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate.
What is the SMILES notation for oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate?
The canonical SMILES for oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate is NCC1(C(=O)OCC2CCOCC2)CCCC1.
What is the InChIKey of oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate?
The InChIKey is IGNGQERDRCAWMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c14-10-13(5-1-2-6-13)12(15)17-9-11-3-7-16-8-4-11/h11H,1-10,14H2.
What are the key properties of oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate?
oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate has a molecular weight of 241.33 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-ylmethyl 1-(aminomethyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 113309279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).