2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid

C7H10O4 — CID 141319368

IUPAC2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid
SMILESCC1=COC(C)(CC(=O)O)O1
InChIInChI=1S/C7H10O4/c1-5-4-10-7(2,11-5)3-6(8)9/h4H,3H2,1-2H3,(H,8,9)
InChIKeyJWMHYLFQNLHLRW-UHFFFAOYSA-N
MW158.15 g/mol
LogP1.09
Rot. Bonds2

About 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid

2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid (PubChem CID 141319368) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid
PubChem CID141319368
Molecular FormulaC7H10O4
Molecular Weight158.15 g/mol
Exact Mass158.06
IUPAC Name2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid
SMILESCC1=COC(C)(CC(=O)O)O1
InChIInChI=1S/C7H10O4/c1-5-4-10-7(2,11-5)3-6(8)9/h4H,3H2,1-2H3,(H,8,9)
InChIKeyJWMHYLFQNLHLRW-UHFFFAOYSA-N
XLogP1.09
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.15
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2,4-dimethyl-1,3-dioxol-2-yl)methanol
CID 141086844
4-methyl-2-(trifluoromethyl)-1,3-dioxole-2-carboxylic acid
CID 178078347
2-(2-methyloxiran-2-yl)acetic acid
CID 87261352
1-(2,4-dimethyl-1,3-dioxol-2-yl)ethanol
CID 162719592
[2-methyl-2-(2-oxopropyl)-1,3-dioxol-4-yl]methyl 2-methylprop-2-enoate
CID 164578547
2-[(5R)-5-methyl-2,4-dioxo-1,3-oxazolidin-5-yl]acetic acid
CID 86707728
iridium;2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)acetic acid
CID 175362501
2-(2-fluoro-4-hydroxy-2-methyl-3H-chromen-4-yl)acetic acid
CID 154342529
2-(6-bromo-2-methyl-4H-1,3-benzodioxin-2-yl)acetic acid
CID 115062931
methane;2-(4-methyl-2-oxo-1,3-dioxan-4-yl)acetic acid
CID 160909748
2-(3,6-dimethyl-2H-1-benzofuran-3-yl)acetic acid
CID 10845939
2-[(4S)-4-methyl-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid
CID 12070940

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid?
The IUPAC name of 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid (CID 141319368) is 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid.
What is the SMILES notation for 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid?
The canonical SMILES for 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid is CC1=COC(C)(CC(=O)O)O1.
What is the InChIKey of 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid?
The InChIKey is JWMHYLFQNLHLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-5-4-10-7(2,11-5)3-6(8)9/h4H,3H2,1-2H3,(H,8,9).
What are the key properties of 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid?
2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid has a molecular weight of 158.15 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-1,3-dioxol-2-yl)acetic acid is sourced from PubChem (CID 141319368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).