C18H21ClO — CID 130398550
4-[4-(4-chlorophenyl)hexan-2-yl]phenol (PubChem CID 130398550) has the molecular formula C18H21ClO and a molecular weight of 288.82 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)hexan-2-yl]phenol.
| Compound Name | 4-[4-(4-chlorophenyl)hexan-2-yl]phenol |
|---|---|
| PubChem CID | 130398550 |
| Molecular Formula | C18H21ClO |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[4-(4-chlorophenyl)hexan-2-yl]phenol |
| SMILES | CCC(CC(C)c1ccc(O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClO/c1-3-14(16-4-8-17(19)9-5-16)12-13(2)15-6-10-18(20)11-7-15/h4-11,13-14,20H,3,12H2,1-2H3 |
| InChIKey | WOVXUTADOUDKKO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |