C19H24O3 — CID 23391465
2-(hydroxymethyl)-4-[5-(4-hydroxyphenyl)hexan-3-yl]phenol (PubChem CID 23391465) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-[5-(4-hydroxyphenyl)hexan-3-yl]phenol.
| Compound Name | 2-(hydroxymethyl)-4-[5-(4-hydroxyphenyl)hexan-3-yl]phenol |
|---|---|
| PubChem CID | 23391465 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-(hydroxymethyl)-4-[5-(4-hydroxyphenyl)hexan-3-yl]phenol |
| SMILES | CCC(CC(C)c1ccc(O)cc1)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C19H24O3/c1-3-14(16-6-9-19(22)17(11-16)12-20)10-13(2)15-4-7-18(21)8-5-15/h4-9,11,13-14,20-22H,3,10,12H2,1-2H3 |
| InChIKey | RNRLCRGPVBYCKR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |