C16H16 — CID 157266886
hexa-2,4-diyne;1-methyl-4-prop-1-ynylbenzene (PubChem CID 157266886) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is hexa-2,4-diyne;1-methyl-4-prop-1-ynylbenzene.
| Compound Name | hexa-2,4-diyne;1-methyl-4-prop-1-ynylbenzene |
|---|---|
| PubChem CID | 157266886 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | hexa-2,4-diyne;1-methyl-4-prop-1-ynylbenzene |
| SMILES | CC#CC#CC.CC#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H10.C6H6/c1-3-4-10-7-5-9(2)6-8-10;1-3-5-6-4-2/h5-8H,1-2H3;1-2H3 |
| InChIKey | AYCDDVUPVXEBDA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|