C28H26Cl2O2 — CID 141149743
2-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarbonyl chloride (PubChem CID 141149743) has the molecular formula C28H26Cl2O2 and a molecular weight of 465.42 g/mol. Its IUPAC name is 2-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarbonyl chloride.
| Compound Name | 2-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 141149743 |
| Molecular Formula | C28H26Cl2O2 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarbonyl chloride |
| SMILES | CC12CC3CC(C)(C1)CC(c1ccc(C#Cc4c(C(=O)Cl)cccc4C(=O)Cl)cc1)(C3)C2 |
| InChI | InChI=1S/C28H26Cl2O2/c1-26-12-19-13-27(2,15-26)17-28(14-19,16-26)20-9-6-18(7-10-20)8-11-21-22(24(29)31)4-3-5-23(21)25(30)32/h3-7,9-10,19H,12-17H2,1-2H3 |
| InChIKey | LCSCFUFQZXTBRK-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|