About 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine
1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine (PubChem CID 5032865) has the molecular formula C23H33NO2S
and a molecular weight of 387.59 g/mol. Its IUPAC name is 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine.
Molecular Properties
| Compound Name | 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine |
| PubChem CID | 5032865 |
| Molecular Formula | C23H33NO2S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine |
| SMILES | CC12CC3CC(C)(C1)CC(c1ccc(S(=O)(=O)N4CCCCC4)cc1)(C3)C2 |
| InChI | InChI=1S/C23H33NO2S/c1-21-12-18-13-22(2,15-21)17-23(14-18,16-21)19-6-8-20(9-7-19)27(25,26)24-10-4-3-5-11-24/h6-9,18H,3-5,10-17H2,1-2H3 |
| InChIKey | ARQNVUMYNYCPND-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine?
The IUPAC name of 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine (CID 5032865) is 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine.
What is the SMILES notation for 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine?
The canonical SMILES for 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine is CC12CC3CC(C)(C1)CC(c1ccc(S(=O)(=O)N4CCCCC4)cc1)(C3)C2.
What is the InChIKey of 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine?
The InChIKey is ARQNVUMYNYCPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO2S/c1-21-12-18-13-22(2,15-21)17-23(14-18,16-21)19-6-8-20(9-7-19)27(25,26)24-10-4-3-5-11-24/h6-9,18H,3-5,10-17H2,1-2H3.
What are the key properties of 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine?
1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine has a molecular weight of 387.59 g/mol, XLogP of 5.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dimethyl-1-adamantyl)phenyl]sulfonylpiperidine is sourced from PubChem (CID 5032865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).