C30H43S+ — CID 162407021
2,6-bis(3,5-dimethyl-1-adamantyl)-4-methylthiopyrylium (PubChem CID 162407021) has the molecular formula C30H43S+ and a molecular weight of 435.74 g/mol. Its IUPAC name is 2,6-bis(3,5-dimethyl-1-adamantyl)-4-methylthiopyrylium.
| Compound Name | 2,6-bis(3,5-dimethyl-1-adamantyl)-4-methylthiopyrylium |
|---|---|
| PubChem CID | 162407021 |
| Molecular Formula | C30H43S+ |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 2,6-bis(3,5-dimethyl-1-adamantyl)-4-methylthiopyrylium |
| SMILES | Cc1cc(C23CC4CC(C)(CC(C)(C4)C2)C3)[s+]c(C23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C30H43S/c1-20-6-23(29-12-21-8-25(2,16-29)14-26(3,9-21)17-29)31-24(7-20)30-13-22-10-27(4,18-30)15-28(5,11-22)19-30/h6-7,21-22H,8-19H2,1-5H3/q+1 |
| InChIKey | SZSDNDLOYBKLFL-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|