C26H35F6PS — CID 162408081
2,6-bis(1-adamantyl)-4-methylthiopyrylium hexafluorophosphate (PubChem CID 162408081) has the molecular formula C26H35F6PS and a molecular weight of 524.60 g/mol. Its IUPAC name is 2,6-bis(1-adamantyl)-4-methylthiopyrylium hexafluorophosphate.
| Compound Name | 2,6-bis(1-adamantyl)-4-methylthiopyrylium hexafluorophosphate |
|---|---|
| PubChem CID | 162408081 |
| Molecular Formula | C26H35F6PS |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2,6-bis(1-adamantyl)-4-methylthiopyrylium hexafluorophosphate |
| SMILES | Cc1cc(C23CC4CC(CC(C4)C2)C3)[s+]c(C23CC4CC(CC(C4)C2)C3)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C26H35S.F6P/c1-16-2-23(25-10-17-4-18(11-25)6-19(5-17)12-25)27-24(3-16)26-13-20-7-21(14-26)9-22(8-20)15-26;1-7(2,3,4,5)6/h2-3,17-22H,4-15H2,1H3;/q+1;-1 |
| InChIKey | NZNWEBZEPZNEIX-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|