C19H26FN — CID 106881477
1-adamantyl-(2-fluoro-4,6-dimethylphenyl)methanamine (PubChem CID 106881477) has the molecular formula C19H26FN and a molecular weight of 287.42 g/mol. Its IUPAC name is 1-adamantyl-(2-fluoro-4,6-dimethylphenyl)methanamine.
| Compound Name | 1-adamantyl-(2-fluoro-4,6-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 106881477 |
| Molecular Formula | C19H26FN |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-adamantyl-(2-fluoro-4,6-dimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)C23CC4CC(CC(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C19H26FN/c1-11-3-12(2)17(16(20)4-11)18(21)19-8-13-5-14(9-19)7-15(6-13)10-19/h3-4,13-15,18H,5-10,21H2,1-2H3 |
| InChIKey | UHYRRSPGCDXAAQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |