C19H26FN — CID 105016628
(3-fluoro-5-methylphenyl)-(3-methyl-1-adamantyl)methanamine (PubChem CID 105016628) has the molecular formula C19H26FN and a molecular weight of 287.42 g/mol. Its IUPAC name is (3-fluoro-5-methylphenyl)-(3-methyl-1-adamantyl)methanamine.
| Compound Name | (3-fluoro-5-methylphenyl)-(3-methyl-1-adamantyl)methanamine |
|---|---|
| PubChem CID | 105016628 |
| Molecular Formula | C19H26FN |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (3-fluoro-5-methylphenyl)-(3-methyl-1-adamantyl)methanamine |
| SMILES | Cc1cc(F)cc(C(N)C23CC4CC(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H26FN/c1-12-3-15(6-16(20)4-12)17(21)19-9-13-5-14(10-19)8-18(2,7-13)11-19/h3-4,6,13-14,17H,5,7-11,21H2,1-2H3 |
| InChIKey | OTOSTPPAWPZURP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |