C19H25FO — CID 79998019
(3,5-dimethyl-1-adamantyl)-(4-fluorophenyl)methanol (PubChem CID 79998019) has the molecular formula C19H25FO and a molecular weight of 288.41 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-(4-fluorophenyl)methanol.
| Compound Name | (3,5-dimethyl-1-adamantyl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 79998019 |
| Molecular Formula | C19H25FO |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-(4-fluorophenyl)methanol |
| SMILES | CC12CC3CC(C)(C1)CC(C(O)c1ccc(F)cc1)(C3)C2 |
| InChI | InChI=1S/C19H25FO/c1-17-7-13-8-18(2,10-17)12-19(9-13,11-17)16(21)14-3-5-15(20)6-4-14/h3-6,13,16,21H,7-12H2,1-2H3 |
| InChIKey | ZPWUWTSLOWYTBF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |