C31H39N3O2 — CID 175626949
N-(4-aminocyclohexyl)-3-phenyl-1'-phenylmethoxyspiro[adamantane-6,2'-aziridine]-1-carboxamide (PubChem CID 175626949) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-phenyl-1'-phenylmethoxyspiro[adamantane-6,2'-aziridine]-1-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-3-phenyl-1'-phenylmethoxyspiro[adamantane-6,2'-aziridine]-1-carboxamide |
|---|---|
| PubChem CID | 175626949 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-phenyl-1'-phenylmethoxyspiro[adamantane-6,2'-aziridine]-1-carboxamide |
| SMILES | NC1CCC(NC(=O)C23CC4CC(c5ccccc5)(CC(C2)C42CN2OCc2ccccc2)C3)CC1 |
| InChI | InChI=1S/C31H39N3O2/c32-26-11-13-27(14-12-26)33-28(35)30-17-24-15-29(20-30,23-9-5-2-6-10-23)16-25(18-30)31(24)21-34(31)36-19-22-7-3-1-4-8-22/h1-10,24-27H,11-21,32H2,(H,33,35) |
| InChIKey | KFQHFVKLSHFHBE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|