C27H41N3O2 — CID 175633191
N-[4-(aminomethyl)cyclohexyl]-6-[(ethoxyamino)methyl]-3-phenyladamantane-1-carboxamide (PubChem CID 175633191) has the molecular formula C27H41N3O2 and a molecular weight of 439.64 g/mol. Its IUPAC name is N-[4-(aminomethyl)cyclohexyl]-6-[(ethoxyamino)methyl]-3-phenyladamantane-1-carboxamide.
| Compound Name | N-[4-(aminomethyl)cyclohexyl]-6-[(ethoxyamino)methyl]-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 175633191 |
| Molecular Formula | C27H41N3O2 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | N-[4-(aminomethyl)cyclohexyl]-6-[(ethoxyamino)methyl]-3-phenyladamantane-1-carboxamide |
| SMILES | CCONCC1C2CC3(C(=O)NC4CCC(CN)CC4)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C27H41N3O2/c1-2-32-29-17-24-20-12-26(22-6-4-3-5-7-22)13-21(24)15-27(14-20,18-26)25(31)30-23-10-8-19(16-28)9-11-23/h3-7,19-21,23-24,29H,2,8-18,28H2,1H3,(H,30,31) |
| InChIKey | FNRGOPAATAJVDM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|