C27H38N2OS — CID 171762359
N-[4-(aminomethyl)cyclohexyl]-6-cyclopropyloxy-3-phenyladamantane-1-carbothioamide (PubChem CID 171762359) has the molecular formula C27H38N2OS and a molecular weight of 438.68 g/mol. Its IUPAC name is N-[4-(aminomethyl)cyclohexyl]-6-cyclopropyloxy-3-phenyladamantane-1-carbothioamide.
| Compound Name | N-[4-(aminomethyl)cyclohexyl]-6-cyclopropyloxy-3-phenyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 171762359 |
| Molecular Formula | C27H38N2OS |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-[4-(aminomethyl)cyclohexyl]-6-cyclopropyloxy-3-phenyladamantane-1-carbothioamide |
| SMILES | NCC1CCC(NC(=S)C23CC4CC(c5ccccc5)(CC(C2)C4OC2CC2)C3)CC1 |
| InChI | InChI=1S/C27H38N2OS/c28-16-18-6-8-22(9-7-18)29-25(31)27-14-19-12-26(17-27,21-4-2-1-3-5-21)13-20(15-27)24(19)30-23-10-11-23/h1-5,18-20,22-24H,6-17,28H2,(H,29,31) |
| InChIKey | BDNLNIIGLIYGPK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|