C26H37ClN2S — CID 171762346
N-(4-aminocyclohexyl)-6-(3-chloropropyl)-3-phenyladamantane-1-carbothioamide (PubChem CID 171762346) has the molecular formula C26H37ClN2S and a molecular weight of 445.12 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-6-(3-chloropropyl)-3-phenyladamantane-1-carbothioamide.
| Compound Name | N-(4-aminocyclohexyl)-6-(3-chloropropyl)-3-phenyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 171762346 |
| Molecular Formula | C26H37ClN2S |
| Molecular Weight | 445.12 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-(4-aminocyclohexyl)-6-(3-chloropropyl)-3-phenyladamantane-1-carbothioamide |
| SMILES | NC1CCC(NC(=S)C23CC4CC(c5ccccc5)(CC(C2)C4CCCCl)C3)CC1 |
| InChI | InChI=1S/C26H37ClN2S/c27-12-4-7-23-18-13-25(20-5-2-1-3-6-20)14-19(23)16-26(15-18,17-25)24(30)29-22-10-8-21(28)9-11-22/h1-3,5-6,18-19,21-23H,4,7-17,28H2,(H,29,30) |
| InChIKey | LEJVXVVIOHJBHQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.12 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|