C25H36N2S — CID 166908976
N-(4-aminocyclohexyl)-1-phenyl-6-propyltricyclo[3.3.1.03,7]nonane-3-carbothioamide (PubChem CID 166908976) has the molecular formula C25H36N2S and a molecular weight of 396.64 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1-phenyl-6-propyltricyclo[3.3.1.03,7]nonane-3-carbothioamide.
| Compound Name | N-(4-aminocyclohexyl)-1-phenyl-6-propyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
|---|---|
| PubChem CID | 166908976 |
| Molecular Formula | C25H36N2S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | N-(4-aminocyclohexyl)-1-phenyl-6-propyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
| SMILES | CCCC1C2CC3(c4ccccc4)CC1C(C(=S)NC1CCC(N)CC1)(C2)C3 |
| InChI | InChI=1S/C25H36N2S/c1-2-6-21-17-13-24(18-7-4-3-5-8-18)15-22(21)25(14-17,16-24)23(28)27-20-11-9-19(26)10-12-20/h3-5,7-8,17,19-22H,2,6,9-16,26H2,1H3,(H,27,28) |
| InChIKey | UTSBAMHXGRQTQJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|