C24H32N2S — CID 162525728
N-[4-(aminomethyl)cyclohexyl]-6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide (PubChem CID 162525728) has the molecular formula C24H32N2S and a molecular weight of 380.60 g/mol. Its IUPAC name is N-[4-(aminomethyl)cyclohexyl]-6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide.
| Compound Name | N-[4-(aminomethyl)cyclohexyl]-6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
|---|---|
| PubChem CID | 162525728 |
| Molecular Formula | C24H32N2S |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[4-(aminomethyl)cyclohexyl]-6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
| SMILES | C=C1C2CC3(c4ccccc4)CC1C(C(=S)NC1CCC(CN)CC1)(C2)C3 |
| InChI | InChI=1S/C24H32N2S/c1-16-18-11-23(19-5-3-2-4-6-19)13-21(16)24(12-18,15-23)22(27)26-20-9-7-17(14-25)8-10-20/h2-6,17-18,20-21H,1,7-15,25H2,(H,26,27) |
| InChIKey | NSAIKKNRHUVDCE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|