C24H32N2S — CID 166985132
(7R)-N-[[4-(aminomethyl)cyclohexyl]methylidene]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide (PubChem CID 166985132) has the molecular formula C24H32N2S and a molecular weight of 380.60 g/mol. Its IUPAC name is (7R)-N-[[4-(aminomethyl)cyclohexyl]methylidene]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide.
| Compound Name | (7R)-N-[[4-(aminomethyl)cyclohexyl]methylidene]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
|---|---|
| PubChem CID | 166985132 |
| Molecular Formula | C24H32N2S |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (7R)-N-[[4-(aminomethyl)cyclohexyl]methylidene]-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
| SMILES | NCC1CCC(/C=N/C(=S)C23CC4C[C@@H]2CC(c2ccccc2)(C4)C3)CC1 |
| InChI | InChI=1S/C24H32N2S/c25-14-17-6-8-18(9-7-17)15-26-22(27)24-12-19-10-21(24)13-23(11-19,16-24)20-4-2-1-3-5-20/h1-5,15,17-19,21H,6-14,16,25H2/b26-15+/t17?,18?,19?,21-,23?,24?/m1/s1 |
| InChIKey | DSUZSXAKRJNGJK-GGICHYIHSA-N |
| XLogP | 5.30 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|