C29H34N2S2 — CID 166985140
N-[[4-(aminomethyl)cyclohexyl]methylidene]-3-phenyl-6-phenylsulfanyltricyclo[3.3.0.03,7]octane-1-carbothioamide (PubChem CID 166985140) has the molecular formula C29H34N2S2 and a molecular weight of 474.74 g/mol. Its IUPAC name is N-[[4-(aminomethyl)cyclohexyl]methylidene]-3-phenyl-6-phenylsulfanyltricyclo[3.3.0.03,7]octane-1-carbothioamide.
| Compound Name | N-[[4-(aminomethyl)cyclohexyl]methylidene]-3-phenyl-6-phenylsulfanyltricyclo[3.3.0.03,7]octane-1-carbothioamide |
|---|---|
| PubChem CID | 166985140 |
| Molecular Formula | C29H34N2S2 |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-[[4-(aminomethyl)cyclohexyl]methylidene]-3-phenyl-6-phenylsulfanyltricyclo[3.3.0.03,7]octane-1-carbothioamide |
| SMILES | NCC1CCC(/C=N/C(=S)C23CC4C(Sc5ccccc5)C2CC4(c2ccccc2)C3)CC1 |
| InChI | InChI=1S/C29H34N2S2/c30-17-20-11-13-21(14-12-20)18-31-27(32)29-16-24-26(33-23-9-5-2-6-10-23)25(29)15-28(24,19-29)22-7-3-1-4-8-22/h1-10,18,20-21,24-26H,11-17,19,30H2/b31-18+ |
| InChIKey | YZICEHDMRUAHNL-FDAWAROLSA-N |
| XLogP | 6.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|