C24H34N2S — CID 175628303
N-[4-(aminomethyl)cyclohexyl]-3-phenyladamantane-1-carbothioamide (PubChem CID 175628303) has the molecular formula C24H34N2S and a molecular weight of 382.62 g/mol. Its IUPAC name is N-[4-(aminomethyl)cyclohexyl]-3-phenyladamantane-1-carbothioamide.
| Compound Name | N-[4-(aminomethyl)cyclohexyl]-3-phenyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 175628303 |
| Molecular Formula | C24H34N2S |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[4-(aminomethyl)cyclohexyl]-3-phenyladamantane-1-carbothioamide |
| SMILES | NCC1CCC(NC(=S)C23CC4CC(C2)CC(c2ccccc2)(C4)C3)CC1 |
| InChI | InChI=1S/C24H34N2S/c25-15-17-6-8-21(9-7-17)26-22(27)24-13-18-10-19(14-24)12-23(11-18,16-24)20-4-2-1-3-5-20/h1-5,17-19,21H,6-16,25H2,(H,26,27) |
| InChIKey | YSSWBEMNUOKMDR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|