C28H38N2O — CID 175627195
N-[4-(aminomethyl)cyclohexyl]-6-(cyclopropylmethylidene)-3-phenyladamantane-1-carboxamide (PubChem CID 175627195) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is N-[4-(aminomethyl)cyclohexyl]-6-(cyclopropylmethylidene)-3-phenyladamantane-1-carboxamide.
| Compound Name | N-[4-(aminomethyl)cyclohexyl]-6-(cyclopropylmethylidene)-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 175627195 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | N-[4-(aminomethyl)cyclohexyl]-6-(cyclopropylmethylidene)-3-phenyladamantane-1-carboxamide |
| SMILES | NCC1CCC(NC(=O)C23CC4CC(c5ccccc5)(CC(C2)C4=CC2CC2)C3)CC1 |
| InChI | InChI=1S/C28H38N2O/c29-17-20-8-10-24(11-9-20)30-26(31)28-15-21-13-27(18-28,23-4-2-1-3-5-23)14-22(16-28)25(21)12-19-6-7-19/h1-5,12,19-22,24H,6-11,13-18,29H2,(H,30,31)/b25-12- |
| InChIKey | QQYTVJZLMVBXLH-ROTLSHHCSA-N |
| XLogP | 5.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|