C26H33F3N2O — CID 162525365
N-(4-aminocyclohexyl)-3-phenyl-6-(3,3,3-trifluoropropylidene)adamantane-1-carboxamide (PubChem CID 162525365) has the molecular formula C26H33F3N2O and a molecular weight of 446.56 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-phenyl-6-(3,3,3-trifluoropropylidene)adamantane-1-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-3-phenyl-6-(3,3,3-trifluoropropylidene)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 162525365 |
| Molecular Formula | C26H33F3N2O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-phenyl-6-(3,3,3-trifluoropropylidene)adamantane-1-carboxamide |
| SMILES | NC1CCC(NC(=O)C23CC4CC(c5ccccc5)(CC(C2)C4=CCC(F)(F)F)C3)CC1 |
| InChI | InChI=1S/C26H33F3N2O/c27-26(28,29)11-10-22-17-12-24(19-4-2-1-3-5-19)13-18(22)15-25(14-17,16-24)23(32)31-21-8-6-20(30)7-9-21/h1-5,10,17-18,20-21H,6-9,11-16,30H2,(H,31,32)/b22-10- |
| InChIKey | BQBHVDYFLVPGMH-YVNNLAQVSA-N |
| XLogP | 5.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|