C26H35ClN2O — CID 162754618
N-[[4-(aminomethyl)cyclohexyl]methylidene]-6-(chloromethyl)-3-phenyladamantane-1-carboxamide (PubChem CID 162754618) has the molecular formula C26H35ClN2O and a molecular weight of 427.03 g/mol. Its IUPAC name is N-[[4-(aminomethyl)cyclohexyl]methylidene]-6-(chloromethyl)-3-phenyladamantane-1-carboxamide.
| Compound Name | N-[[4-(aminomethyl)cyclohexyl]methylidene]-6-(chloromethyl)-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 162754618 |
| Molecular Formula | C26H35ClN2O |
| Molecular Weight | 427.03 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[[4-(aminomethyl)cyclohexyl]methylidene]-6-(chloromethyl)-3-phenyladamantane-1-carboxamide |
| SMILES | NCC1CCC(/C=N/C(=O)C23CC4CC(c5ccccc5)(CC(C2)C4CCl)C3)CC1 |
| InChI | InChI=1S/C26H35ClN2O/c27-14-23-20-10-25(22-4-2-1-3-5-22)11-21(23)13-26(12-20,17-25)24(30)29-16-19-8-6-18(15-28)7-9-19/h1-5,16,18-21,23H,6-15,17,28H2/b29-16+ |
| InChIKey | VDBLJGQARSRMRA-MUFRIFMGSA-N |
| XLogP | 5.35 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|