C27H38N2S — CID 162754434
N-[(4-aminocyclohexyl)methylidene]-3-phenyl-6-propyladamantane-1-carbothioamide (PubChem CID 162754434) has the molecular formula C27H38N2S and a molecular weight of 422.68 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methylidene]-3-phenyl-6-propyladamantane-1-carbothioamide.
| Compound Name | N-[(4-aminocyclohexyl)methylidene]-3-phenyl-6-propyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 162754434 |
| Molecular Formula | C27H38N2S |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | N-[(4-aminocyclohexyl)methylidene]-3-phenyl-6-propyladamantane-1-carbothioamide |
| SMILES | CCCC1C2CC3(C(=S)/N=C/C4CCC(N)CC4)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C27H38N2S/c1-2-6-24-20-13-26(22-7-4-3-5-8-22)14-21(24)16-27(15-20,18-26)25(30)29-17-19-9-11-23(28)12-10-19/h3-5,7-8,17,19-21,23-24H,2,6,9-16,18,28H2,1H3/b29-17+ |
| InChIKey | FENMKNXYLZOBDK-STBIYBPSSA-N |
| XLogP | 6.47 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|