C26H41NS — CID 162525919
cyclohexanamine;6-ethyl-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde (PubChem CID 162525919) has the molecular formula C26H41NS and a molecular weight of 399.69 g/mol. Its IUPAC name is cyclohexanamine;6-ethyl-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde.
| Compound Name | cyclohexanamine;6-ethyl-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde |
|---|---|
| PubChem CID | 162525919 |
| Molecular Formula | C26H41NS |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | cyclohexanamine;6-ethyl-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde |
| SMILES | CCC1C(C)CC2(c3ccccc3)CC1CC(C)(C=S)C2.NC1CCCCC1 |
| InChI | InChI=1S/C20H28S.C6H13N/c1-4-18-15(2)10-20(17-8-6-5-7-9-17)12-16(18)11-19(3,13-20)14-21;7-6-4-2-1-3-5-6/h5-9,14-16,18H,4,10-13H2,1-3H3;6H,1-5,7H2 |
| InChIKey | ZKNUDLDHNAINDI-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|