C21H28F2S — CID 162525839
6-(2,2-difluoroethyl)-3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde (PubChem CID 162525839) has the molecular formula C21H28F2S and a molecular weight of 350.52 g/mol. Its IUPAC name is 6-(2,2-difluoroethyl)-3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde.
| Compound Name | 6-(2,2-difluoroethyl)-3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde |
|---|---|
| PubChem CID | 162525839 |
| Molecular Formula | C21H28F2S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 6-(2,2-difluoroethyl)-3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C=S)C2)C1(C)CC(F)F |
| InChI | InChI=1S/C21H28F2S/c1-15-9-21(16-7-5-4-6-8-16)11-17(10-19(2,13-21)14-24)20(15,3)12-18(22)23/h4-8,14-15,17-18H,9-13H2,1-3H3 |
| InChIKey | IGWPJPWPUXBJAB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|