C19H25F2NS — CID 166908419
3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide (PubChem CID 166908419) has the molecular formula C19H25F2NS and a molecular weight of 337.48 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide.
| Compound Name | 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide |
|---|---|
| PubChem CID | 166908419 |
| Molecular Formula | C19H25F2NS |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide |
| SMILES | CCC1CC2(c3ccccc3)CC(CC(F)F)CC1(C(N)=S)C2 |
| InChI | InChI=1S/C19H25F2NS/c1-2-14-11-18(15-6-4-3-5-7-15)9-13(8-16(20)21)10-19(14,12-18)17(22)23/h3-7,13-14,16H,2,8-12H2,1H3,(H2,22,23) |
| InChIKey | ULQQXIWVSFNYSK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|