C23H24ClNS — CID 166985086
(5S)-6-benzyl-6-chloro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide (PubChem CID 166985086) has the molecular formula C23H24ClNS and a molecular weight of 381.97 g/mol. Its IUPAC name is (5S)-6-benzyl-6-chloro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide.
| Compound Name | (5S)-6-benzyl-6-chloro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
|---|---|
| PubChem CID | 166985086 |
| Molecular Formula | C23H24ClNS |
| Molecular Weight | 381.97 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (5S)-6-benzyl-6-chloro-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
| SMILES | NC(=S)C12C[C@@H]3CC(c4ccccc4)(CC1C3(Cl)Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H24ClNS/c24-23(11-16-7-3-1-4-8-16)18-12-21(17-9-5-2-6-10-17)14-19(23)22(13-18,15-21)20(25)26/h1-10,18-19H,11-15H2,(H2,25,26)/t18-,19?,21?,22?,23?/m0/s1 |
| InChIKey | GPHVNHCRJLYDIM-BNYIKMMFSA-N |
| XLogP | 5.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|