C19H26F2N2S — CID 166985134
7-[(difluoromethylamino)methyl]-3-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide (PubChem CID 166985134) has the molecular formula C19H26F2N2S and a molecular weight of 352.49 g/mol. Its IUPAC name is 7-[(difluoromethylamino)methyl]-3-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide.
| Compound Name | 7-[(difluoromethylamino)methyl]-3-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide |
|---|---|
| PubChem CID | 166985134 |
| Molecular Formula | C19H26F2N2S |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 7-[(difluoromethylamino)methyl]-3-ethyl-5-phenylbicyclo[3.2.1]octane-1-carbothioamide |
| SMILES | CCC1CC2(c3ccccc3)CC(CNC(F)F)C(C(N)=S)(C1)C2 |
| InChI | InChI=1S/C19H26F2N2S/c1-2-13-8-18(14-6-4-3-5-7-14)10-15(11-23-17(20)21)19(9-13,12-18)16(22)24/h3-7,13,15,17,23H,2,8-12H2,1H3,(H2,22,24) |
| InChIKey | JKJRWLLXBHAHHG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|