About 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide
3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide (PubChem CID 162754583) has the molecular formula C19H27NS
and a molecular weight of 301.50 g/mol. Its IUPAC name is 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide.
Molecular Properties
| Compound Name | 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide |
| PubChem CID | 162754583 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide |
| SMILES | CCC1(c2ccccc2)CC2CC(C(N)=S)(C1)CC2(C)C |
| InChI | InChI=1S/C19H27NS/c1-4-18(14-8-6-5-7-9-14)10-15-11-19(13-18,16(20)21)12-17(15,2)3/h5-9,15H,4,10-13H2,1-3H3,(H2,20,21) |
| InChIKey | JQFQODBPQNQOSY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide?
The IUPAC name of 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide (CID 162754583) is 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide.
What is the SMILES notation for 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide?
The canonical SMILES for 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide is CCC1(c2ccccc2)CC2CC(C(N)=S)(C1)CC2(C)C.
What is the InChIKey of 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide?
The InChIKey is JQFQODBPQNQOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NS/c1-4-18(14-8-6-5-7-9-14)10-15-11-19(13-18,16(20)21)12-17(15,2)3/h5-9,15H,4,10-13H2,1-3H3,(H2,20,21).
What are the key properties of 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide?
3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide has a molecular weight of 301.50 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide is sourced from PubChem (CID 162754583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).