C19H27NS — CID 162754583
3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide (PubChem CID 162754583) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide.
| Compound Name | 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide |
|---|---|
| PubChem CID | 162754583 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 3-ethyl-6,6-dimethyl-3-phenylbicyclo[3.2.1]octane-1-carbothioamide |
| SMILES | CCC1(c2ccccc2)CC2CC(C(N)=S)(C1)CC2(C)C |
| InChI | InChI=1S/C19H27NS/c1-4-18(14-8-6-5-7-9-14)10-15-11-19(13-18,16(20)21)12-17(15,2)3/h5-9,15H,4,10-13H2,1-3H3,(H2,20,21) |
| InChIKey | JQFQODBPQNQOSY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|