C21H25NS — CID 162754737
(6Z)-3-phenyl-6-propylidenetetracyclo[5.3.1.03,9.05,9]undecane-1-carbothioamide (PubChem CID 162754737) has the molecular formula C21H25NS and a molecular weight of 323.51 g/mol. Its IUPAC name is (6Z)-3-phenyl-6-propylidenetetracyclo[5.3.1.03,9.05,9]undecane-1-carbothioamide.
| Compound Name | (6Z)-3-phenyl-6-propylidenetetracyclo[5.3.1.03,9.05,9]undecane-1-carbothioamide |
|---|---|
| PubChem CID | 162754737 |
| Molecular Formula | C21H25NS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (6Z)-3-phenyl-6-propylidenetetracyclo[5.3.1.03,9.05,9]undecane-1-carbothioamide |
| SMILES | CC/C=C1/C2CC3(C(N)=S)CC4(c5ccccc5)CC1C4(C2)C3 |
| InChI | InChI=1S/C21H25NS/c1-2-6-16-14-9-19(18(22)23)12-20(15-7-4-3-5-8-15)11-17(16)21(20,10-14)13-19/h3-8,14,17H,2,9-13H2,1H3,(H2,22,23)/b16-6- |
| InChIKey | QRGWDLBGWYQFJR-SOFYXZRVSA-N |
| XLogP | 4.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|