C20H23NO — CID 162525467
(6E)-3-phenyl-6-propylidenetetracyclo[5.2.1.03,8.05,8]decane-1-carboxamide (PubChem CID 162525467) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (6E)-3-phenyl-6-propylidenetetracyclo[5.2.1.03,8.05,8]decane-1-carboxamide.
| Compound Name | (6E)-3-phenyl-6-propylidenetetracyclo[5.2.1.03,8.05,8]decane-1-carboxamide |
|---|---|
| PubChem CID | 162525467 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (6E)-3-phenyl-6-propylidenetetracyclo[5.2.1.03,8.05,8]decane-1-carboxamide |
| SMILES | CC/C=C1/C2CC3(C(N)=O)CC4(c5ccccc5)CC1C24C3 |
| InChI | InChI=1S/C20H23NO/c1-2-6-14-15-9-18(17(21)22)11-19(13-7-4-3-5-8-13)10-16(14)20(15,19)12-18/h3-8,15-16H,2,9-12H2,1H3,(H2,21,22)/b14-6- |
| InChIKey | LQKZFPGQVFMSCV-NSIKDUERSA-N |
| XLogP | 3.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|