C24H30O3 — CID 162754516
formaldehyde;methyl (6E)-6-butylidene-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxylate (PubChem CID 162754516) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is formaldehyde;methyl (6E)-6-butylidene-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxylate.
| Compound Name | formaldehyde;methyl (6E)-6-butylidene-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxylate |
|---|---|
| PubChem CID | 162754516 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | formaldehyde;methyl (6E)-6-butylidene-3-phenyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxylate |
| SMILES | C=O.CCC/C=C1\C2CC3(C(=O)OC)CC4(c5ccccc5)CC1C4(C2)C3 |
| InChI | InChI=1S/C23H28O2.CH2O/c1-3-4-10-18-16-11-21(20(24)25-2)14-22(17-8-6-5-7-9-17)13-19(18)23(22,12-16)15-21;1-2/h5-10,16,19H,3-4,11-15H2,1-2H3;1H2/b18-10+; |
| InChIKey | YSCRFDKUZYETTA-DYMYMWKRSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|