C39H46F4O7S — CID 157394534
methyl 3-(fluoromethyl)-5-phenyladamantane-1-carboxylate;methyl 3-phenyl-5-(trifluoromethylsulfonyloxymethyl)adamantane-1-carboxylate (PubChem CID 157394534) has the molecular formula C39H46F4O7S and a molecular weight of 734.85 g/mol. Its IUPAC name is methyl 3-(fluoromethyl)-5-phenyladamantane-1-carboxylate;methyl 3-phenyl-5-(trifluoromethylsulfonyloxymethyl)adamantane-1-carboxylate.
| Compound Name | methyl 3-(fluoromethyl)-5-phenyladamantane-1-carboxylate;methyl 3-phenyl-5-(trifluoromethylsulfonyloxymethyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 157394534 |
| Molecular Formula | C39H46F4O7S |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.29 |
| IUPAC Name | methyl 3-(fluoromethyl)-5-phenyladamantane-1-carboxylate;methyl 3-phenyl-5-(trifluoromethylsulfonyloxymethyl)adamantane-1-carboxylate |
| SMILES | COC(=O)C12CC3CC(CF)(C1)CC(c1ccccc1)(C3)C2.COC(=O)C12CC3CC(COS(=O)(=O)C(F)(F)F)(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C20H23F3O5S.C19H23FO2/c1-27-16(24)19-9-14-7-17(11-19,13-28-29(25,26)20(21,22)23)10-18(8-14,12-19)15-5-3-2-4-6-15;1-22-16(21)19-9-14-7-17(11-19,13-20)10-18(8-14,12-19)15-5-3-2-4-6-15/h2-6,14H,7-13H2,1H3;2-6,14H,7-13H2,1H3 |
| InChIKey | BMKJCVGMUCXROC-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|