About (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide
(6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide (PubChem CID 162526016) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide.
Molecular Properties
| Compound Name | (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide |
| PubChem CID | 162526016 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide |
| SMILES | C/C=C1/C2CC3(C(N)=O)CC4(c5ccccc5)CC1C234 |
| InChI | InChI=1S/C18H19NO/c1-2-12-13-8-16(11-6-4-3-5-7-11)10-17(15(19)20)9-14(12)18(13,16)17/h2-7,13-14H,8-10H2,1H3,(H2,19,20)/b12-2+ |
| InChIKey | VSDAVCCJMLPYJS-SWGQDTFXSA-N |
| XLogP | 2.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide?
The IUPAC name of (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide (CID 162526016) is (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide.
What is the SMILES notation for (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide?
The canonical SMILES for (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide is C/C=C1/C2CC3(C(N)=O)CC4(c5ccccc5)CC1C234.
What is the InChIKey of (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide?
The InChIKey is VSDAVCCJMLPYJS-SWGQDTFXSA-N. The full InChI is InChI=1S/C18H19NO/c1-2-12-13-8-16(11-6-4-3-5-7-11)10-17(15(19)20)9-14(12)18(13,16)17/h2-7,13-14H,8-10H2,1H3,(H2,19,20)/b12-2+.
What are the key properties of (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide?
(6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide has a molecular weight of 265.36 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-ethylidene-3-phenyltetracyclo[3.3.1.03,9.07,9]nonane-1-carboxamide is sourced from PubChem (CID 162526016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).