C18H26N2 — CID 141394164
5,7-dimethyl-1-phenyladamantane-2,2-diamine (PubChem CID 141394164) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 5,7-dimethyl-1-phenyladamantane-2,2-diamine.
| Compound Name | 5,7-dimethyl-1-phenyladamantane-2,2-diamine |
|---|---|
| PubChem CID | 141394164 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 5,7-dimethyl-1-phenyladamantane-2,2-diamine |
| SMILES | CC12CC3CC(C)(C1)CC(c1ccccc1)(C2)C3(N)N |
| InChI | InChI=1S/C18H26N2/c1-15-8-14-9-16(2,10-15)12-17(11-15,18(14,19)20)13-6-4-3-5-7-13/h3-7,14H,8-12,19-20H2,1-2H3 |
| InChIKey | UENQOMMVYGLZOX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|