C23H34N2 — CID 137436018
1-[[(3R,5R)-3-methyl-5-phenyl-1-adamantyl]methyl]piperidin-4-amine (PubChem CID 137436018) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-[[(3R,5R)-3-methyl-5-phenyl-1-adamantyl]methyl]piperidin-4-amine.
| Compound Name | 1-[[(3R,5R)-3-methyl-5-phenyl-1-adamantyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 137436018 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1-[[(3R,5R)-3-methyl-5-phenyl-1-adamantyl]methyl]piperidin-4-amine |
| SMILES | C[C@]12CC3CC(CN4CCC(N)CC4)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H34N2/c1-21-11-18-12-22(14-21,17-25-9-7-20(24)8-10-25)16-23(13-18,15-21)19-5-3-2-4-6-19/h2-6,18,20H,7-17,24H2,1H3/t18?,21-,22?,23+/m0/s1 |
| InChIKey | ZAUMWHQQGQOHLL-LWZIIBGRSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |