C27H30O2 — CID 98182607
[(1R,3R,5R,7S)-3-methyl-5-phenyl-1-adamantyl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 98182607) has the molecular formula C27H30O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is [(1R,3R,5R,7S)-3-methyl-5-phenyl-1-adamantyl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,3R,5R,7S)-3-methyl-5-phenyl-1-adamantyl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 98182607 |
| Molecular Formula | C27H30O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [(1R,3R,5R,7S)-3-methyl-5-phenyl-1-adamantyl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | C[C@]12C[C@@H]3C[C@@](COC(=O)/C=C/c4ccccc4)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C27H30O2/c1-25-14-22-15-26(17-25,19-27(16-22,18-25)23-10-6-3-7-11-23)20-29-24(28)13-12-21-8-4-2-5-9-21/h2-13,22H,14-20H2,1H3/b13-12+/t22-,25+,26-,27-/m1/s1 |
| InChIKey | OLBCEDGRPPJIEM-LRJOLLIASA-N |
| XLogP | 6.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|