C21H26O2 — CID 57365969
3-tricyclo[4.3.1.13,8]undecanylmethyl 3-phenylprop-2-enoate (PubChem CID 57365969) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-tricyclo[4.3.1.13,8]undecanylmethyl 3-phenylprop-2-enoate.
| Compound Name | 3-tricyclo[4.3.1.13,8]undecanylmethyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 57365969 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 3-tricyclo[4.3.1.13,8]undecanylmethyl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OCC12CCC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26O2/c22-20(7-6-16-4-2-1-3-5-16)23-15-21-9-8-17-10-18(13-21)12-19(11-17)14-21/h1-7,17-19H,8-15H2 |
| InChIKey | LYSQUAREXFWZCX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|