C16H23N — CID 97036416
(1R,2S,4R)-1,7,7-trimethyl-4-phenylbicyclo[2.2.1]heptan-2-amine (PubChem CID 97036416) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (1R,2S,4R)-1,7,7-trimethyl-4-phenylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2S,4R)-1,7,7-trimethyl-4-phenylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 97036416 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (1R,2S,4R)-1,7,7-trimethyl-4-phenylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)[C@]2(c3ccccc3)CC[C@@]1(C)[C@@H](N)C2 |
| InChI | InChI=1S/C16H23N/c1-14(2)15(3)9-10-16(14,11-13(15)17)12-7-5-4-6-8-12/h4-8,13H,9-11,17H2,1-3H3/t13-,15-,16+/m0/s1 |
| InChIKey | NEAWUDPEOCRETE-CWRNSKLLSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |