C17H24OSi — CID 101272906
trimethyl-[(Z)-2-[(1S)-2-methyl-2-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethenyl]silane (PubChem CID 101272906) has the molecular formula C17H24OSi and a molecular weight of 272.46 g/mol. Its IUPAC name is trimethyl-[(Z)-2-[(1S)-2-methyl-2-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethenyl]silane.
| Compound Name | trimethyl-[(Z)-2-[(1S)-2-methyl-2-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethenyl]silane |
|---|---|
| PubChem CID | 101272906 |
| Molecular Formula | C17H24OSi |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | trimethyl-[(Z)-2-[(1S)-2-methyl-2-phenyl-3-oxabicyclo[3.1.0]hexan-1-yl]ethenyl]silane |
| SMILES | CC1(c2ccccc2)OCC2C[C@@]21/C=C\[Si](C)(C)C |
| InChI | InChI=1S/C17H24OSi/c1-16(14-8-6-5-7-9-14)17(10-11-19(2,3)4)12-15(17)13-18-16/h5-11,15H,12-13H2,1-4H3/b11-10-/t15?,16?,17-/m0/s1 |
| InChIKey | RAWKMVLYCAGATQ-JOFDOEGZSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|