About [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane
[(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane (PubChem CID 11833308) has the molecular formula C19H22OSi
and a molecular weight of 294.47 g/mol. Its IUPAC name is [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane |
| PubChem CID | 11833308 |
| Molecular Formula | C19H22OSi |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/C1OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22OSi/c1-21(2,3)15-14-18-19(20-18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15,18H,1-3H3/b15-14+ |
| InChIKey | LFPXKOMQCMCXPZ-CCEZHUSRSA-N |
| XLogP | 4.76 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane?
The IUPAC name of [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane (CID 11833308) is [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane.
What is the SMILES notation for [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane?
The canonical SMILES for [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane is C[Si](C)(C)/C=C/C1OC1(c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane?
The InChIKey is LFPXKOMQCMCXPZ-CCEZHUSRSA-N. The full InChI is InChI=1S/C19H22OSi/c1-21(2,3)15-14-18-19(20-18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15,18H,1-3H3/b15-14+.
What are the key properties of [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane?
[(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane has a molecular weight of 294.47 g/mol, XLogP of 4.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-(3,3-diphenyloxiran-2-yl)ethenyl]-trimethylsilane is sourced from PubChem (CID 11833308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).