C16H14BrNO — CID 12637259
4-bromo-3-methyl-5,5-diphenyl-4H-1,2-oxazole (PubChem CID 12637259) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is 4-bromo-3-methyl-5,5-diphenyl-4H-1,2-oxazole.
| Compound Name | 4-bromo-3-methyl-5,5-diphenyl-4H-1,2-oxazole |
|---|---|
| PubChem CID | 12637259 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-bromo-3-methyl-5,5-diphenyl-4H-1,2-oxazole |
| SMILES | CC1=NOC(c2ccccc2)(c2ccccc2)C1Br |
| InChI | InChI=1S/C16H14BrNO/c1-12-15(17)16(19-18-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3 |
| InChIKey | KLZQOKWXLMCRLJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|