C20H30 — CID 162525772
3,3,6,6,7-pentamethyl-1-phenylbicyclo[3.3.1]nonane (PubChem CID 162525772) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 3,3,6,6,7-pentamethyl-1-phenylbicyclo[3.3.1]nonane.
| Compound Name | 3,3,6,6,7-pentamethyl-1-phenylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 162525772 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3,3,6,6,7-pentamethyl-1-phenylbicyclo[3.3.1]nonane |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C)C2)C1(C)C |
| InChI | InChI=1S/C20H30/c1-15-11-20(16-9-7-6-8-10-16)13-17(19(15,4)5)12-18(2,3)14-20/h6-10,15,17H,11-14H2,1-5H3 |
| InChIKey | FQVCSPFVVBBBDL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |