C21H32FNO — CID 162525701
6-(2-fluoroethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide (PubChem CID 162525701) has the molecular formula C21H32FNO and a molecular weight of 333.49 g/mol. Its IUPAC name is 6-(2-fluoroethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide.
| Compound Name | 6-(2-fluoroethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide |
|---|---|
| PubChem CID | 162525701 |
| Molecular Formula | C21H32FNO |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 6-(2-fluoroethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C)C2)C1CCF.NC=O |
| InChI | InChI=1S/C20H29F.CH3NO/c1-15-11-20(17-7-5-4-6-8-17)13-16(18(15)9-10-21)12-19(2,3)14-20;2-1-3/h4-8,15-16,18H,9-14H2,1-3H3;1H,(H2,2,3) |
| InChIKey | QMJXTSDWNXTZPB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|